Molecular Docking of Opiates: Achieving binding energies exceeding –20 kcal/mol
Yaroslav G. Zaitsev ORCID: 0000-0002-0069-2997 Date: 28.01.2026 DOI: https://doi.org/10.5281/zenodo.18402445 E-mail nabrosovnabrosov@gmail.com The structure has an unprecedented triple viscous and massive grip and all-pervasive architecture, exceeding the binding energy of known opioids and botulinum toxin: OC(COc1cccc2ccccc12)C(C(O)COc3cccc4ccccc34)N5CCOCCOCCOCCOCCOCCOCC5 Keywords: Molecular Docking, Binding Affinity, Mu-Opioid Receptor (MOR), Synthetic Opioids